C15H13ClFNO6 — CID 168540661
methyl 2-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-6-fluorobenzoate (PubChem CID 168540661) has the molecular formula C15H13ClFNO6 and a molecular weight of 357.72 g/mol. Its IUPAC name is methyl 2-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-6-fluorobenzoate.
| Compound Name | methyl 2-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-6-fluorobenzoate |
|---|---|
| PubChem CID | 168540661 |
| Molecular Formula | C15H13ClFNO6 |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | methyl 2-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)ccc(NC=C2C(=O)OC(C)(C)OC2=O)c1Cl |
| InChI | InChI=1S/C15H13ClFNO6/c1-15(2)23-12(19)7(13(20)24-15)6-18-9-5-4-8(17)10(11(9)16)14(21)22-3/h4-6,18H,1-3H3 |
| InChIKey | DNEZXVCXPKCZNR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|