C19H18N2O7 — CID 168539099
ethyl 2-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-1,3-oxazole-4-carboxylate (PubChem CID 168539099) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is ethyl 2-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 168539099 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | ethyl 2-[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(-c2ccccc2NC=C2C(=O)OC(C)(C)OC2=O)n1 |
| InChI | InChI=1S/C19H18N2O7/c1-4-25-18(24)14-10-26-15(21-14)11-7-5-6-8-13(11)20-9-12-16(22)27-19(2,3)28-17(12)23/h5-10,20H,4H2,1-3H3 |
| InChIKey | TVHGWAILPZPOMW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|