About ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate
ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate (PubChem CID 142693900) has the molecular formula C13H12FNO4
and a molecular weight of 265.24 g/mol. Its IUPAC name is ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate.
Analyze ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate (CID 142693900) is ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate is CCOC(=O)c1coc(-c2cc(F)ccc2OC)n1.
What is the InChIKey of ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate?
The InChIKey is LHYDCXXAWRRXOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO4/c1-3-18-13(16)10-7-19-12(15-10)9-6-8(14)4-5-11(9)17-2/h4-7H,3H2,1-2H3.
What are the key properties of ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate?
ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate has a molecular weight of 265.24 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 142693900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).