C12H11FN4O3 — CID 25103537
N-(diaminomethylidene)-2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 25103537) has the molecular formula C12H11FN4O3 and a molecular weight of 278.24 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(diaminomethylidene)-2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 25103537 |
| Molecular Formula | C12H11FN4O3 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-(diaminomethylidene)-2-(5-fluoro-2-methoxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(F)cc1-c1nc(C(=O)N=C(N)N)co1 |
| InChI | InChI=1S/C12H11FN4O3/c1-19-9-3-2-6(13)4-7(9)11-16-8(5-20-11)10(18)17-12(14)15/h2-5H,1H3,(H4,14,15,17,18) |
| InChIKey | DCQQCQCKKCIZHU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|