C11H8Cl2N4O2 — CID 25103423
N-(diaminomethylidene)-2-(2,5-dichlorophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 25103423) has the molecular formula C11H8Cl2N4O2 and a molecular weight of 299.12 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(2,5-dichlorophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(diaminomethylidene)-2-(2,5-dichlorophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 25103423 |
| Molecular Formula | C11H8Cl2N4O2 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-(diaminomethylidene)-2-(2,5-dichlorophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | NC(N)=NC(=O)c1coc(-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C11H8Cl2N4O2/c12-5-1-2-7(13)6(3-5)10-16-8(4-19-10)9(18)17-11(14)15/h1-4H,(H4,14,15,17,18) |
| InChIKey | LDAOWBSTBKLLOC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|