C12H9Cl2N3O2 — CID 11483373
N-(diaminomethylidene)-5-(2,5-dichlorophenyl)furan-2-carboxamide (PubChem CID 11483373) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is N-(diaminomethylidene)-5-(2,5-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-5-(2,5-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 11483373 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | N-(diaminomethylidene)-5-(2,5-dichlorophenyl)furan-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C12H9Cl2N3O2/c13-6-1-2-8(14)7(5-6)9-3-4-10(19-9)11(18)17-12(15)16/h1-5H,(H4,15,16,17,18) |
| InChIKey | VLCZVCQMCJGEDW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|