C13H12Cl2N2O2 — CID 124514749
(3R)-3-amino-3-[5-(2,5-dichlorophenyl)furan-2-yl]propanamide (PubChem CID 124514749) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is (3R)-3-amino-3-[5-(2,5-dichlorophenyl)furan-2-yl]propanamide.
| Compound Name | (3R)-3-amino-3-[5-(2,5-dichlorophenyl)furan-2-yl]propanamide |
|---|---|
| PubChem CID | 124514749 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (3R)-3-amino-3-[5-(2,5-dichlorophenyl)furan-2-yl]propanamide |
| SMILES | NC(=O)C[C@@H](N)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C13H12Cl2N2O2/c14-7-1-2-9(15)8(5-7)11-3-4-12(19-11)10(16)6-13(17)18/h1-5,10H,6,16H2,(H2,17,18)/t10-/m1/s1 |
| InChIKey | PVBGDBVQEVLOJF-SNVBAGLBSA-N |
| XLogP | 3.13 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |