C14H13F3N2O3 — CID 170876267
3-amino-3-[5-[4-(trifluoromethoxy)phenyl]furan-2-yl]propanamide (PubChem CID 170876267) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 3-amino-3-[5-[4-(trifluoromethoxy)phenyl]furan-2-yl]propanamide.
| Compound Name | 3-amino-3-[5-[4-(trifluoromethoxy)phenyl]furan-2-yl]propanamide |
|---|---|
| PubChem CID | 170876267 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-amino-3-[5-[4-(trifluoromethoxy)phenyl]furan-2-yl]propanamide |
| SMILES | NC(=O)CC(N)c1ccc(-c2ccc(OC(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C14H13F3N2O3/c15-14(16,17)22-9-3-1-8(2-4-9)11-5-6-12(21-11)10(18)7-13(19)20/h1-6,10H,7,18H2,(H2,19,20) |
| InChIKey | DOQJYJFGDMWEMR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |