C11H8F3N3O3 — CID 86711960
5-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 86711960) has the molecular formula C11H8F3N3O3 and a molecular weight of 287.20 g/mol. Its IUPAC name is 5-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 86711960 |
| Molecular Formula | C11H8F3N3O3 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 5-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | NNC(=O)c1cc(-c2ccc(OC(F)(F)F)cc2)on1 |
| InChI | InChI=1S/C11H8F3N3O3/c12-11(13,14)19-7-3-1-6(2-4-7)9-5-8(17-20-9)10(18)16-15/h1-5H,15H2,(H,16,18) |
| InChIKey | LFKKJWLMUGOLOB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|