C13H14Cl2O — CID 143821579
2-(2,5-dichlorophenyl)-5-methylfuran;ethane (PubChem CID 143821579) has the molecular formula C13H14Cl2O and a molecular weight of 257.16 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-5-methylfuran;ethane.
| Compound Name | 2-(2,5-dichlorophenyl)-5-methylfuran;ethane |
|---|---|
| PubChem CID | 143821579 |
| Molecular Formula | C13H14Cl2O |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-5-methylfuran;ethane |
| SMILES | CC.Cc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C11H8Cl2O.C2H6/c1-7-2-5-11(14-7)9-6-8(12)3-4-10(9)13;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | OOYDBPTTYAVOTC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |