C12H9F2N3O2 — CID 11737171
N-(diaminomethylidene)-5-(2,5-difluorophenyl)furan-2-carboxamide (PubChem CID 11737171) has the molecular formula C12H9F2N3O2 and a molecular weight of 265.22 g/mol. Its IUPAC name is N-(diaminomethylidene)-5-(2,5-difluorophenyl)furan-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-5-(2,5-difluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 11737171 |
| Molecular Formula | C12H9F2N3O2 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(diaminomethylidene)-5-(2,5-difluorophenyl)furan-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc(-c2cc(F)ccc2F)o1 |
| InChI | InChI=1S/C12H9F2N3O2/c13-6-1-2-8(14)7(5-6)9-3-4-10(19-9)11(18)17-12(15)16/h1-5H,(H4,15,16,17,18) |
| InChIKey | RJRBYRCXEMSVIR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|