C11H7F2NO2 — CID 82114716
5-(2,4-difluorophenyl)furan-2-carboxamide (PubChem CID 82114716) has the molecular formula C11H7F2NO2 and a molecular weight of 223.18 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)furan-2-carboxamide.
| Compound Name | 5-(2,4-difluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82114716 |
| Molecular Formula | C11H7F2NO2 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 5-(2,4-difluorophenyl)furan-2-carboxamide |
| SMILES | NC(=O)c1ccc(-c2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C11H7F2NO2/c12-6-1-2-7(8(13)5-6)9-3-4-10(16-9)11(14)15/h1-5H,(H2,14,15) |
| InChIKey | ZONYUAAWQPAPDG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |