C13H7F2O3- — CID 7164671
(E)-3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enoate (PubChem CID 7164671) has the molecular formula C13H7F2O3- and a molecular weight of 249.19 g/mol. Its IUPAC name is (E)-3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enoate.
| Compound Name | (E)-3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7164671 |
| Molecular Formula | C13H7F2O3- |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (E)-3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1ccc(-c2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C13H8F2O3/c14-8-1-4-10(11(15)7-8)12-5-2-9(18-12)3-6-13(16)17/h1-7H,(H,16,17)/p-1/b6-3+ |
| InChIKey | PUFRUEMJSQVGSX-ZZXKWVIFSA-M |
| XLogP | 1.99 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|