C13H10NO5S- — CID 7128748
(E)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enoate (PubChem CID 7128748) has the molecular formula C13H10NO5S- and a molecular weight of 292.29 g/mol. Its IUPAC name is (E)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enoate.
| Compound Name | (E)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7128748 |
| Molecular Formula | C13H10NO5S- |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (E)-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enoate |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(/C=C/C(=O)[O-])o2)cc1 |
| InChI | InChI=1S/C13H11NO5S/c14-20(17,18)11-5-1-9(2-6-11)12-7-3-10(19-12)4-8-13(15)16/h1-8H,(H,15,16)(H2,14,17,18)/p-1/b8-4+ |
| InChIKey | NJCUFFUYNUDDFT-XBXARRHUSA-M |
| XLogP | 0.36 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|