C16H13N3O4S2 — CID 9211886
N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]thiophene-2-carboxamide (PubChem CID 9211886) has the molecular formula C16H13N3O4S2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9211886 |
| Molecular Formula | C16H13N3O4S2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(/C=N\NC(=O)c3cccs3)o2)cc1 |
| InChI | InChI=1S/C16H13N3O4S2/c17-25(21,22)13-6-3-11(4-7-13)14-8-5-12(23-14)10-18-19-16(20)15-2-1-9-24-15/h1-10H,(H,19,20)(H2,17,21,22)/b18-10- |
| InChIKey | KTPJAPCZQBMBAK-ZDLGFXPLSA-N |
| XLogP | 2.42 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|