C21H22N4O3S2 — CID 42992296
1-(4-propan-2-ylphenyl)-3-[(E)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]thiourea (PubChem CID 42992296) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-3-[(E)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]thiourea.
| Compound Name | 1-(4-propan-2-ylphenyl)-3-[(E)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 42992296 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-3-[(E)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]thiourea |
| SMILES | CC(C)c1ccc(NC(=S)N/N=C/c2ccc(-c3ccc(S(N)(=O)=O)cc3)o2)cc1 |
| InChI | InChI=1S/C21H22N4O3S2/c1-14(2)15-3-7-17(8-4-15)24-21(29)25-23-13-18-9-12-20(28-18)16-5-10-19(11-6-16)30(22,26)27/h3-14H,1-2H3,(H2,22,26,27)(H2,24,25,29)/b23-13+ |
| InChIKey | OXEVAIHDSXEEDP-YDZHTSKRSA-N |
| XLogP | 4.04 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|