C19H17N3OS — CID 4046043
1-(4-methylphenyl)-3-[(5-phenylfuran-2-yl)methylideneamino]thiourea (PubChem CID 4046043) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[(5-phenylfuran-2-yl)methylideneamino]thiourea.
| Compound Name | 1-(4-methylphenyl)-3-[(5-phenylfuran-2-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 4046043 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(4-methylphenyl)-3-[(5-phenylfuran-2-yl)methylideneamino]thiourea |
| SMILES | Cc1ccc(NC(=S)NN=Cc2ccc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C19H17N3OS/c1-14-7-9-16(10-8-14)21-19(24)22-20-13-17-11-12-18(23-17)15-5-3-2-4-6-15/h2-13H,1H3,(H2,21,22,24) |
| InChIKey | YLXPINUAQWWTQS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|