C18H13FN4O3S — CID 2725401
1-(4-fluorophenyl)-3-[[5-(3-nitrophenyl)furan-2-yl]methylideneamino]thiourea (PubChem CID 2725401) has the molecular formula C18H13FN4O3S and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[[5-(3-nitrophenyl)furan-2-yl]methylideneamino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[[5-(3-nitrophenyl)furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 2725401 |
| Molecular Formula | C18H13FN4O3S |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[[5-(3-nitrophenyl)furan-2-yl]methylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(C=NNC(=S)Nc3ccc(F)cc3)o2)c1 |
| InChI | InChI=1S/C18H13FN4O3S/c19-13-4-6-14(7-5-13)21-18(27)22-20-11-16-8-9-17(26-16)12-2-1-3-15(10-12)23(24)25/h1-11H,(H2,21,22,27) |
| InChIKey | GYCGSWKPRFUJGN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|