C17H14ClN3O3S — CID 3765394
4-[2-[[5-(3-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 3765394) has the molecular formula C17H14ClN3O3S and a molecular weight of 375.84 g/mol. Its IUPAC name is 4-[2-[[5-(3-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | 4-[2-[[5-(3-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3765394 |
| Molecular Formula | C17H14ClN3O3S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 4-[2-[[5-(3-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NN=Cc2ccc(-c3cccc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C17H14ClN3O3S/c18-13-3-1-2-12(10-13)17-9-6-15(24-17)11-20-21-14-4-7-16(8-5-14)25(19,22)23/h1-11,21H,(H2,19,22,23) |
| InChIKey | VDCPZBJGZSMDPI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|