C18H13Cl3N2O — CID 19060006
N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine (PubChem CID 19060006) has the molecular formula C18H13Cl3N2O and a molecular weight of 379.67 g/mol. Its IUPAC name is N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine.
| Compound Name | N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 19060006 |
| Molecular Formula | C18H13Cl3N2O |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
| SMILES | Clc1cccc(-c2ccc(/C=N/NCc3c(Cl)cccc3Cl)o2)c1 |
| InChI | InChI=1S/C18H13Cl3N2O/c19-13-4-1-3-12(9-13)18-8-7-14(24-18)10-22-23-11-15-16(20)5-2-6-17(15)21/h1-10,23H,11H2/b22-10+ |
| InChIKey | JJXMUGSBRLHVML-LSHDLFTRSA-N |
| XLogP | 6.03 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|