C25H17ClN2O3 — CID 95395767
N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-9H-xanthene-9-carboxamide (PubChem CID 95395767) has the molecular formula C25H17ClN2O3 and a molecular weight of 428.88 g/mol. Its IUPAC name is N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-9H-xanthene-9-carboxamide.
| Compound Name | N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 95395767 |
| Molecular Formula | C25H17ClN2O3 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-9H-xanthene-9-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2cccc(Cl)c2)o1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C25H17ClN2O3/c26-17-7-5-6-16(14-17)21-13-12-18(30-21)15-27-28-25(29)24-19-8-1-3-10-22(19)31-23-11-4-2-9-20(23)24/h1-15,24H,(H,28,29)/b27-15- |
| InChIKey | JTGFTQCWBWZNCO-DICXZTSXSA-N |
| XLogP | 5.99 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|