C15H8ClF7N2O2 — CID 26074510
N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 26074510) has the molecular formula C15H8ClF7N2O2 and a molecular weight of 416.68 g/mol. Its IUPAC name is N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 26074510 |
| Molecular Formula | C15H8ClF7N2O2 |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(N/N=C/c1ccc(-c2cccc(Cl)c2)o1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H8ClF7N2O2/c16-9-3-1-2-8(6-9)11-5-4-10(27-11)7-24-25-12(26)13(17,18)14(19,20)15(21,22)23/h1-7H,(H,25,26)/b24-7+ |
| InChIKey | UOCSXUOCPAKZPZ-HCBMXOAHSA-N |
| XLogP | 4.88 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|