C19H13N2O6S- — CID 3155195
5-[(9H-xanthene-9-carbonylhydrazinylidene)methyl]furan-2-sulfonate (PubChem CID 3155195) has the molecular formula C19H13N2O6S- and a molecular weight of 397.39 g/mol. Its IUPAC name is 5-[(9H-xanthene-9-carbonylhydrazinylidene)methyl]furan-2-sulfonate.
| Compound Name | 5-[(9H-xanthene-9-carbonylhydrazinylidene)methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 3155195 |
| Molecular Formula | C19H13N2O6S- |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 5-[(9H-xanthene-9-carbonylhydrazinylidene)methyl]furan-2-sulfonate |
| SMILES | O=C(NN=Cc1ccc(S(=O)(=O)[O-])o1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C19H14N2O6S/c22-19(21-20-11-12-9-10-17(26-12)28(23,24)25)18-13-5-1-3-7-15(13)27-16-8-4-2-6-14(16)18/h1-11,18H,(H,21,22)(H,23,24,25)/p-1 |
| InChIKey | XHQHAPTUMPYPEQ-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|