C12H8FN2NaO5S — CID 171151557
sodium 5-[[(4-fluorobenzoyl)hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 171151557) has the molecular formula C12H8FN2NaO5S and a molecular weight of 334.26 g/mol. Its IUPAC name is sodium 5-[[(4-fluorobenzoyl)hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[[(4-fluorobenzoyl)hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 171151557 |
| Molecular Formula | C12H8FN2NaO5S |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | sodium 5-[[(4-fluorobenzoyl)hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | O=C(NN=Cc1ccc(S(=O)(=O)[O-])o1)c1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C12H9FN2O5S.Na/c13-9-3-1-8(2-4-9)12(16)15-14-7-10-5-6-11(20-10)21(17,18)19;/h1-7H,(H,15,16)(H,17,18,19);/q;+1/p-1 |
| InChIKey | FQPFAKVUFDCJKO-UHFFFAOYSA-M |
| XLogP | -1.91 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|