C12H8N3NaO7S — CID 44784402
sodium 5-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 44784402) has the molecular formula C12H8N3NaO7S and a molecular weight of 361.27 g/mol. Its IUPAC name is sodium 5-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 44784402 |
| Molecular Formula | C12H8N3NaO7S |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | sodium 5-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | O=C(N/N=C/c1ccc(S(=O)(=O)[O-])o1)c1ccc([N+](=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C12H9N3O7S.Na/c16-12(8-1-3-9(4-2-8)15(17)18)14-13-7-10-5-6-11(22-10)23(19,20)21;/h1-7H,(H,14,16)(H,19,20,21);/q;+1/p-1/b13-7+; |
| InChIKey | JOAGSLNXHMYRRE-FTPOTTDRSA-M |
| XLogP | -2.14 |
| TPSA | 154.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|