C12H9N2NaO5S — CID 171151438
sodium 5-[(benzoylhydrazinylidene)methyl]furan-2-sulfonate (PubChem CID 171151438) has the molecular formula C12H9N2NaO5S and a molecular weight of 316.27 g/mol. Its IUPAC name is sodium 5-[(benzoylhydrazinylidene)methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[(benzoylhydrazinylidene)methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 171151438 |
| Molecular Formula | C12H9N2NaO5S |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | sodium 5-[(benzoylhydrazinylidene)methyl]furan-2-sulfonate |
| SMILES | O=C(NN=Cc1ccc(S(=O)(=O)[O-])o1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C12H10N2O5S.Na/c15-12(9-4-2-1-3-5-9)14-13-8-10-6-7-11(19-10)20(16,17)18;/h1-8H,(H,14,15)(H,16,17,18);/q;+1/p-1 |
| InChIKey | WYFQUXDOAZBIEO-UHFFFAOYSA-M |
| XLogP | -2.05 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|