C19H14N3NaO6S2 — CID 171669473
sodium 5-[(E)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 171669473) has the molecular formula C19H14N3NaO6S2 and a molecular weight of 467.46 g/mol. Its IUPAC name is sodium 5-[(E)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[(E)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 171669473 |
| Molecular Formula | C19H14N3NaO6S2 |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | sodium 5-[(E)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | O=C(N/N=C/c1ccc(S(=O)(=O)[O-])o1)/C(=C\c1cccs1)NC(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C19H15N3O6S2.Na/c23-18(13-5-2-1-3-6-13)21-16(11-15-7-4-10-29-15)19(24)22-20-12-14-8-9-17(28-14)30(25,26)27;/h1-12H,(H,21,23)(H,22,24)(H,25,26,27);/q;+1/p-1/b16-11+,20-12+; |
| InChIKey | LULYGUWAVMKLGS-ZUWSYNNFSA-M |
| XLogP | -0.83 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|