C17H14N3NaO5S — CID 171151497
sodium 5-[[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 171151497) has the molecular formula C17H14N3NaO5S and a molecular weight of 395.37 g/mol. Its IUPAC name is sodium 5-[[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 171151497 |
| Molecular Formula | C17H14N3NaO5S |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | sodium 5-[[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | O=C(CNc1ccc2ccccc2c1)NN=Cc1ccc(S(=O)(=O)[O-])o1.[Na+] |
| InChI | InChI=1S/C17H15N3O5S.Na/c21-16(20-19-10-15-7-8-17(25-15)26(22,23)24)11-18-14-6-5-12-3-1-2-4-13(12)9-14;/h1-10,18H,11H2,(H,20,21)(H,22,23,24);/q;+1/p-1 |
| InChIKey | SFOVATXHUAQAPS-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|