C20H17Br2N3O — CID 71066400
N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide (PubChem CID 71066400) has the molecular formula C20H17Br2N3O and a molecular weight of 475.18 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide.
| Compound Name | N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
|---|---|
| PubChem CID | 71066400 |
| Molecular Formula | C20H17Br2N3O |
| Molecular Weight | 475.18 g/mol |
| Exact Mass | 472.97 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-4-methylphenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
| SMILES | Cc1c(Br)cc(/C=N\NC(=O)CNc2ccc3ccccc3c2)cc1Br |
| InChI | InChI=1S/C20H17Br2N3O/c1-13-18(21)8-14(9-19(13)22)11-24-25-20(26)12-23-17-7-6-15-4-2-3-5-16(15)10-17/h2-11,23H,12H2,1H3,(H,25,26)/b24-11- |
| InChIKey | QGVUYLOXYUQJID-MYKKPKGFSA-N |
| XLogP | 5.24 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.18 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|