C17H13Br2N3O2 — CID 6886154
N-[(E)-(4,5-dibromofuran-2-yl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide (PubChem CID 6886154) has the molecular formula C17H13Br2N3O2 and a molecular weight of 451.12 g/mol. Its IUPAC name is N-[(E)-(4,5-dibromofuran-2-yl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide.
| Compound Name | N-[(E)-(4,5-dibromofuran-2-yl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
|---|---|
| PubChem CID | 6886154 |
| Molecular Formula | C17H13Br2N3O2 |
| Molecular Weight | 451.12 g/mol |
| Exact Mass | 448.94 |
| IUPAC Name | N-[(E)-(4,5-dibromofuran-2-yl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
| SMILES | O=C(CNc1ccc2ccccc2c1)N/N=C/c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C17H13Br2N3O2/c18-15-8-14(24-17(15)19)9-21-22-16(23)10-20-13-6-5-11-3-1-2-4-12(11)7-13/h1-9,20H,10H2,(H,22,23)/b21-9+ |
| InChIKey | VDTDSODNMJNFHT-ZVBGSRNCSA-N |
| XLogP | 4.52 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.12 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|