C26H19Br2N3O3 — CID 6286095
[2,4-dibromo-6-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 6286095) has the molecular formula C26H19Br2N3O3 and a molecular weight of 581.26 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 6286095 |
| Molecular Formula | C26H19Br2N3O3 |
| Molecular Weight | 581.26 g/mol |
| Exact Mass | 578.98 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CNc1ccc2ccccc2c1)N/N=C\c1cc(Br)cc(Br)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H19Br2N3O3/c27-21-12-20(25(23(28)14-21)34-26(33)18-7-2-1-3-8-18)15-30-31-24(32)16-29-22-11-10-17-6-4-5-9-19(17)13-22/h1-15,29H,16H2,(H,31,32)/b30-15- |
| InChIKey | OATVKOWCHJUYQY-MNDYBZJGSA-N |
| XLogP | 6.15 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.26 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|