C19H15Br2N3O2 — CID 1268496
N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide (PubChem CID 1268496) has the molecular formula C19H15Br2N3O2 and a molecular weight of 477.16 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
|---|---|
| PubChem CID | 1268496 |
| Molecular Formula | C19H15Br2N3O2 |
| Molecular Weight | 477.16 g/mol |
| Exact Mass | 474.95 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
| SMILES | O=C(CNc1ccc2ccccc2c1)NN=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C19H15Br2N3O2/c20-16-7-12(8-17(21)19(16)26)10-23-24-18(25)11-22-15-6-5-13-3-1-2-4-14(13)9-15/h1-10,22,26H,11H2,(H,24,25) |
| InChIKey | TWBBVWTWXXMCIJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.16 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|