C16H12Br2F3N3O3 — CID 136653431
N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-[4-(trifluoromethoxy)anilino]acetamide (PubChem CID 136653431) has the molecular formula C16H12Br2F3N3O3 and a molecular weight of 511.09 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-[4-(trifluoromethoxy)anilino]acetamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-[4-(trifluoromethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 136653431 |
| Molecular Formula | C16H12Br2F3N3O3 |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 508.92 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-[4-(trifluoromethoxy)anilino]acetamide |
| SMILES | O=C(CNc1ccc(OC(F)(F)F)cc1)NN=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C16H12Br2F3N3O3/c17-12-5-9(6-13(18)15(12)26)7-23-24-14(25)8-22-10-1-3-11(4-2-10)27-16(19,20)21/h1-7,22,26H,8H2,(H,24,25) |
| InChIKey | KEYYOPVKUCNZQU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|