C16H11Br2ClF3N3O2 — CID 135923685
2-[4-chloro-3-(trifluoromethyl)anilino]-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135923685) has the molecular formula C16H11Br2ClF3N3O2 and a molecular weight of 529.54 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)anilino]-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)anilino]-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135923685 |
| Molecular Formula | C16H11Br2ClF3N3O2 |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 526.89 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)anilino]-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc(Cl)c(C(F)(F)F)c1)N/N=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C16H11Br2ClF3N3O2/c17-11-3-8(4-12(18)15(11)27)6-24-25-14(26)7-23-9-1-2-13(19)10(5-9)16(20,21)22/h1-6,23,27H,7H2,(H,25,26)/b24-6+ |
| InChIKey | DUDQYOJUXPRIJE-GFXGDVFHSA-N |
| XLogP | 5.15 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|