C24H19Br2N3O — CID 59770955
2-(anthracen-2-ylamino)-N-[(E)-(3,5-dibromo-4-methylphenyl)methylideneamino]acetamide (PubChem CID 59770955) has the molecular formula C24H19Br2N3O and a molecular weight of 525.24 g/mol. Its IUPAC name is 2-(anthracen-2-ylamino)-N-[(E)-(3,5-dibromo-4-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(anthracen-2-ylamino)-N-[(E)-(3,5-dibromo-4-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 59770955 |
| Molecular Formula | C24H19Br2N3O |
| Molecular Weight | 525.24 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | 2-(anthracen-2-ylamino)-N-[(E)-(3,5-dibromo-4-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1c(Br)cc(/C=N/NC(=O)CNc2ccc3cc4ccccc4cc3c2)cc1Br |
| InChI | InChI=1S/C24H19Br2N3O/c1-15-22(25)8-16(9-23(15)26)13-28-29-24(30)14-27-21-7-6-19-10-17-4-2-3-5-18(17)11-20(19)12-21/h2-13,27H,14H2,1H3,(H,29,30)/b28-13+ |
| InChIKey | RZXNYRBLABZVNG-XODNFHPESA-N |
| XLogP | 6.39 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.24 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|