C19H14BrN4O4- — CID 7083716
4-bromo-2-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]-6-nitrophenolate (PubChem CID 7083716) has the molecular formula C19H14BrN4O4- and a molecular weight of 442.25 g/mol. Its IUPAC name is 4-bromo-2-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]-6-nitrophenolate.
| Compound Name | 4-bromo-2-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7083716 |
| Molecular Formula | C19H14BrN4O4- |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 4-bromo-2-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]-6-nitrophenolate |
| SMILES | O=C(CNc1ccc2ccccc2c1)N/N=C\c1cc(Br)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C19H15BrN4O4/c20-15-7-14(19(26)17(9-15)24(27)28)10-22-23-18(25)11-21-16-6-5-12-3-1-2-4-13(12)8-16/h1-10,21,26H,11H2,(H,23,25)/p-1/b22-10- |
| InChIKey | BOASRMIIYSFYLJ-YVNNLAQVSA-M |
| XLogP | 3.15 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|