C20H11BrN3O5- — CID 6876488
2-[(E)-(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]-4-bromo-6-nitrophenolate (PubChem CID 6876488) has the molecular formula C20H11BrN3O5- and a molecular weight of 453.23 g/mol. Its IUPAC name is 2-[(E)-(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]-4-bromo-6-nitrophenolate.
| Compound Name | 2-[(E)-(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]-4-bromo-6-nitrophenolate |
|---|---|
| PubChem CID | 6876488 |
| Molecular Formula | C20H11BrN3O5- |
| Molecular Weight | 453.23 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 2-[(E)-(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]-4-bromo-6-nitrophenolate |
| SMILES | O=C(N/N=C/c1cc(Br)cc([N+](=O)[O-])c1[O-])c1cc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C20H12BrN3O5/c21-13-7-12(19(25)16(8-13)24(27)28)10-22-23-20(26)18-9-15-14-4-2-1-3-11(14)5-6-17(15)29-18/h1-10,25H,(H,23,26)/p-1/b22-10+ |
| InChIKey | NCTOYSKTPHNTIQ-LSHDLFTRSA-M |
| XLogP | 4.09 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|