C24H19BrN2O5 — CID 1003027
ethyl 2-[2-[(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]-4-bromophenoxy]acetate (PubChem CID 1003027) has the molecular formula C24H19BrN2O5 and a molecular weight of 495.33 g/mol. Its IUPAC name is ethyl 2-[2-[(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]-4-bromophenoxy]acetate.
| Compound Name | ethyl 2-[2-[(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]-4-bromophenoxy]acetate |
|---|---|
| PubChem CID | 1003027 |
| Molecular Formula | C24H19BrN2O5 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | ethyl 2-[2-[(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]-4-bromophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1C=NNC(=O)c1cc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C24H19BrN2O5/c1-2-30-23(28)14-31-20-10-8-17(25)11-16(20)13-26-27-24(29)22-12-19-18-6-4-3-5-15(18)7-9-21(19)32-22/h3-13H,2,14H2,1H3,(H,27,29) |
| InChIKey | MYSDWOLZKHVVMV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|