C14H14BrN5O4 — CID 4607494
ethyl 2-[4-bromo-2-[(1H-1,2,4-triazole-5-carbonylhydrazinylidene)methyl]phenoxy]acetate (PubChem CID 4607494) has the molecular formula C14H14BrN5O4 and a molecular weight of 396.20 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(1H-1,2,4-triazole-5-carbonylhydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(1H-1,2,4-triazole-5-carbonylhydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4607494 |
| Molecular Formula | C14H14BrN5O4 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(1H-1,2,4-triazole-5-carbonylhydrazinylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1C=NNC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C14H14BrN5O4/c1-2-23-12(21)7-24-11-4-3-10(15)5-9(11)6-17-20-14(22)13-16-8-18-19-13/h3-6,8H,2,7H2,1H3,(H,20,22)(H,16,18,19) |
| InChIKey | FMXAAPHYWNHGGO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|