C19H19BrN2O6 — CID 126217235
ethyl 2-[5-[(Z)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 126217235) has the molecular formula C19H19BrN2O6 and a molecular weight of 451.27 g/mol. Its IUPAC name is ethyl 2-[5-[(Z)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-[(Z)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126217235 |
| Molecular Formula | C19H19BrN2O6 |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | ethyl 2-[5-[(Z)-[(5-bromo-2-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(/C=N\NC(=O)c2cc(Br)ccc2O)ccc1OC |
| InChI | InChI=1S/C19H19BrN2O6/c1-3-27-18(24)11-28-17-8-12(4-7-16(17)26-2)10-21-22-19(25)14-9-13(20)5-6-15(14)23/h4-10,23H,3,11H2,1-2H3,(H,22,25)/b21-10- |
| InChIKey | MHTSFMNAMIXOFA-FBHDLOMBSA-N |
| XLogP | 2.87 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|