C16H14BrN4O4- — CID 7341365
4-bromo-2-[(Z)-[[2-(4-methylanilino)acetyl]hydrazinylidene]methyl]-6-nitrophenolate (PubChem CID 7341365) has the molecular formula C16H14BrN4O4- and a molecular weight of 406.22 g/mol. Its IUPAC name is 4-bromo-2-[(Z)-[[2-(4-methylanilino)acetyl]hydrazinylidene]methyl]-6-nitrophenolate.
| Compound Name | 4-bromo-2-[(Z)-[[2-(4-methylanilino)acetyl]hydrazinylidene]methyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7341365 |
| Molecular Formula | C16H14BrN4O4- |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 4-bromo-2-[(Z)-[[2-(4-methylanilino)acetyl]hydrazinylidene]methyl]-6-nitrophenolate |
| SMILES | Cc1ccc(NCC(=O)N/N=C\c2cc(Br)cc([N+](=O)[O-])c2[O-])cc1 |
| InChI | InChI=1S/C16H15BrN4O4/c1-10-2-4-13(5-3-10)18-9-15(22)20-19-8-11-6-12(17)7-14(16(11)23)21(24)25/h2-8,18,23H,9H2,1H3,(H,20,22)/p-1/b19-8- |
| InChIKey | XJCGXPODMCSFLN-UWVJOHFNSA-M |
| XLogP | 2.30 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|