C15H9Br2N3O2 — CID 2311190
N-[(4,5-dibromofuran-2-yl)methylideneamino]quinoline-2-carboxamide (PubChem CID 2311190) has the molecular formula C15H9Br2N3O2 and a molecular weight of 423.06 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methylideneamino]quinoline-2-carboxamide.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methylideneamino]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 2311190 |
| Molecular Formula | C15H9Br2N3O2 |
| Molecular Weight | 423.06 g/mol |
| Exact Mass | 420.91 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methylideneamino]quinoline-2-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)c(Br)o1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H9Br2N3O2/c16-11-7-10(22-14(11)17)8-18-20-15(21)13-6-5-9-3-1-2-4-12(9)19-13/h1-8H,(H,20,21) |
| InChIKey | BCPFAMAALQJUFN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.06 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|