C25H29N3O2 — CID 9499718
N-[(Z)-(2-octoxyphenyl)methylideneamino]quinoline-2-carboxamide (PubChem CID 9499718) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[(Z)-(2-octoxyphenyl)methylideneamino]quinoline-2-carboxamide.
| Compound Name | N-[(Z)-(2-octoxyphenyl)methylideneamino]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 9499718 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[(Z)-(2-octoxyphenyl)methylideneamino]quinoline-2-carboxamide |
| SMILES | CCCCCCCCOc1ccccc1/C=N\NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C25H29N3O2/c1-2-3-4-5-6-11-18-30-24-15-10-8-13-21(24)19-26-28-25(29)23-17-16-20-12-7-9-14-22(20)27-23/h7-10,12-17,19H,2-6,11,18H2,1H3,(H,28,29)/b26-19- |
| InChIKey | JXBOSYQTASGNEN-XHPQRKPJSA-N |
| XLogP | 5.74 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|