C24H28N4O3 — CID 110339499
N-[(E)-(2-hexoxyphenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide (PubChem CID 110339499) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[(E)-(2-hexoxyphenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide.
| Compound Name | N-[(E)-(2-hexoxyphenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
|---|---|
| PubChem CID | 110339499 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-[(E)-(2-hexoxyphenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
| SMILES | CCCCCCOc1ccccc1/C=N/NC(=O)CCc1nc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C24H28N4O3/c1-2-3-4-9-16-31-22-13-8-5-10-18(22)17-25-28-23(29)15-14-21-24(30)27-20-12-7-6-11-19(20)26-21/h5-8,10-13,17H,2-4,9,14-16H2,1H3,(H,27,30)(H,28,29)/b25-17+ |
| InChIKey | ISQLDVRXRQNKKD-KOEQRZSOSA-N |
| XLogP | 3.97 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|