C20H19ClN4O4 — CID 110509730
N-[(Z)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide (PubChem CID 110509730) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide.
| Compound Name | N-[(Z)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
|---|---|
| PubChem CID | 110509730 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[(Z)-(2-chloro-3,4-dimethoxyphenyl)methylideneamino]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
| SMILES | COc1ccc(/C=N\NC(=O)CCc2nc3ccccc3[nH]c2=O)c(Cl)c1OC |
| InChI | InChI=1S/C20H19ClN4O4/c1-28-16-9-7-12(18(21)19(16)29-2)11-22-25-17(26)10-8-15-20(27)24-14-6-4-3-5-13(14)23-15/h3-7,9,11H,8,10H2,1-2H3,(H,24,27)(H,25,26)/b22-11- |
| InChIKey | CQHCBRHLCRVSEU-JJFYIABZSA-N |
| XLogP | 2.68 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|