C25H27FN4O3 — CID 110525841
4-(4-fluorophenyl)-N-[(E)-(2-heptoxyphenyl)methylideneamino]-2-oxo-1H-pyrimidine-6-carboxamide (PubChem CID 110525841) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[(E)-(2-heptoxyphenyl)methylideneamino]-2-oxo-1H-pyrimidine-6-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-[(E)-(2-heptoxyphenyl)methylideneamino]-2-oxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110525841 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[(E)-(2-heptoxyphenyl)methylideneamino]-2-oxo-1H-pyrimidine-6-carboxamide |
| SMILES | CCCCCCCOc1ccccc1/C=N/NC(=O)c1cc(-c2ccc(F)cc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C25H27FN4O3/c1-2-3-4-5-8-15-33-23-10-7-6-9-19(23)17-27-30-24(31)22-16-21(28-25(32)29-22)18-11-13-20(26)14-12-18/h6-7,9-14,16-17H,2-5,8,15H2,1H3,(H,30,31)(H,28,29,32)/b27-17+ |
| InChIKey | PDSZLXSAWFAUNE-WPWMEQJKSA-N |
| XLogP | 4.69 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|