C22H22N4O4 — CID 110525482
N-[(E)-(3-methoxy-2-propoxyphenyl)methylideneamino]-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide (PubChem CID 110525482) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[(E)-(3-methoxy-2-propoxyphenyl)methylideneamino]-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-(3-methoxy-2-propoxyphenyl)methylideneamino]-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110525482 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[(E)-(3-methoxy-2-propoxyphenyl)methylideneamino]-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide |
| SMILES | CCCOc1c(/C=N/NC(=O)c2cc(-c3ccccc3)nc(=O)[nH]2)cccc1OC |
| InChI | InChI=1S/C22H22N4O4/c1-3-12-30-20-16(10-7-11-19(20)29-2)14-23-26-21(27)18-13-17(24-22(28)25-18)15-8-5-4-6-9-15/h4-11,13-14H,3,12H2,1-2H3,(H,26,27)(H,24,25,28)/b23-14+ |
| InChIKey | VEBNVZREPMJXDV-OEAKJJBVSA-N |
| XLogP | 3.00 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|