C20H17N5O6 — CID 110525558
N-[(E)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide (PubChem CID 110525558) has the molecular formula C20H17N5O6 and a molecular weight of 423.39 g/mol. Its IUPAC name is N-[(E)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110525558 |
| Molecular Formula | C20H17N5O6 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[(E)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=N/NC(=O)c1cc(-c2ccccc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C20H17N5O6/c1-30-17-10-18(31-2)16(25(28)29)8-13(17)11-21-24-19(26)15-9-14(22-20(27)23-15)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,24,26)(H,22,23,27)/b21-11+ |
| InChIKey | POIUKHKWBUZORG-SRZZPIQSSA-N |
| XLogP | 2.13 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|