C16H16N4O6 — CID 110523579
N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-1-methyl-2-oxopyridine-3-carboxamide (PubChem CID 110523579) has the molecular formula C16H16N4O6 and a molecular weight of 360.33 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-1-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-1-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110523579 |
| Molecular Formula | C16H16N4O6 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-1-methyl-2-oxopyridine-3-carboxamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=N\NC(=O)c1cccn(C)c1=O |
| InChI | InChI=1S/C16H16N4O6/c1-19-6-4-5-11(16(19)22)15(21)18-17-9-10-7-12(20(23)24)14(26-3)8-13(10)25-2/h4-9H,1-3H3,(H,18,21)/b17-9- |
| InChIKey | ICZFAWCCOBVSQI-MFOYZWKCSA-N |
| XLogP | 1.07 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|