C19H15FN4O2 — CID 110525871
4-(4-fluorophenyl)-N-[(E)-(2-methylphenyl)methylideneamino]-2-oxo-1H-pyrimidine-6-carboxamide (PubChem CID 110525871) has the molecular formula C19H15FN4O2 and a molecular weight of 350.35 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[(E)-(2-methylphenyl)methylideneamino]-2-oxo-1H-pyrimidine-6-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-[(E)-(2-methylphenyl)methylideneamino]-2-oxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110525871 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[(E)-(2-methylphenyl)methylideneamino]-2-oxo-1H-pyrimidine-6-carboxamide |
| SMILES | Cc1ccccc1/C=N/NC(=O)c1cc(-c2ccc(F)cc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C19H15FN4O2/c1-12-4-2-3-5-14(12)11-21-24-18(25)17-10-16(22-19(26)23-17)13-6-8-15(20)9-7-13/h2-11H,1H3,(H,24,25)(H,22,23,26)/b21-11+ |
| InChIKey | DZDALGBTEUFYTF-SRZZPIQSSA-N |
| XLogP | 2.65 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|